CAS 38954-67-5
:β-D-Glucopyranoside, octyl, 2,3,4,6-tetraacetate
Description:
β-D-Glucopyranoside, octyl, 2,3,4,6-tetraacetate, with CAS number 38954-67-5, is a glycoside derivative of glucose characterized by the presence of an octyl group and four acetyl groups attached to the glucose moiety. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic octyl chain. The acetylation of the hydroxyl groups enhances its lipophilicity, making it useful in various applications, including as a surfactant or emulsifier in formulations. Its structure allows for potential interactions in biological systems, which may influence its behavior in biochemical processes. The compound is often studied for its role in carbohydrate chemistry and its potential applications in drug delivery systems, where the modification of sugar moieties can affect solubility and permeability. Safety data and handling precautions should be observed, as with all chemical substances, to ensure safe usage in laboratory and industrial settings.
Formula:C22H36O10
InChI:InChI=1S/C22H36O10/c1-6-7-8-9-10-11-12-27-22-21(31-17(5)26)20(30-16(4)25)19(29-15(3)24)18(32-22)13-28-14(2)23/h18-22H,6-13H2,1-5H3/t18-,19-,20+,21-,22-/m1/s1
InChI key:InChIKey=RNGLREVZONTJLS-QMCAAQAGSA-N
SMILES:O(C(C)=O)[C@H]1[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@@H](OCCCCCCCC)[C@@H]1OC(C)=O
Synonyms:- Glucopyranoside, octyl, tetraacetate
- β-D-Glucopyranoside, octyl, 2,3,4,6-tetraacetate
- β-D-Glucopyranoside, octyl, tetraacetate
- β-D-Tetraacetyloctyl glucoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-O-Octyl-β-d-glucopyranoside 2,3,4,6-tetraacetate
CAS:Formula:C22H36O10Purity:95%Color and Shape:SolidMolecular weight:460.5152(2R,3R,4S,5R,6R)-2-(Acetoxymethyl)-6-(octyloxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate
CAS:(2R,3R,4S,5R,6R)-2-(Acetoxymethyl)-6-(octyloxy)tetrahydro-2H-pyran-3,4,5-triyl triacetatePurity:97%Octyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside
CAS:Formula:C22H36O10Purity:≥ 95.0%Color and Shape:White to off-white powderMolecular weight:460.52(2R,3R,4S,5R,6R)-2-(Acetoxymethyl)-6-(octyloxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate
CAS:Purity:97%Molecular weight:460.23Octyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside
CAS:Octyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside is an analog of 6-(trifluoromethyl)indoxyl beta-D-galactopyranoside. It is a potent antituberculosis agent that inhibits the growth of Mycobacterium tuberculosis and has been shown to be active against other bacteria in vitro. Octyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside inhibits bacterial growth by binding to DNA dependent RNA polymerase and prevents transcription and replication. This compound has been tested for its ability to inhibit neoplastic cell proliferation in humans.Formula:C22H36O10Purity:(%) Min. 95%Color and Shape:PowderMolecular weight:460.52 g/mol




