CAS 38956-79-5

3-hydrazinyl-6-methylpyridazine

Description:

3-Hydrazinyl-6-methylpyridazine is an organic compound characterized by its hydrazine functional group and a pyridazine ring structure. The presence of the hydrazinyl group (-NH-NH2) indicates that it can participate in various chemical reactions, including those typical of hydrazines, such as oxidation and condensation reactions. The methyl group at the 6-position of the pyridazine ring contributes to the compound's hydrophobic characteristics and can influence its reactivity and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could lead to applications in pharmaceuticals. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 3-hydrazinyl-6-methylpyridazine is a versatile compound with potential applications in various fields, including organic synthesis and medicinal chemistry.

Formula: C₅H₈N₄

InChI: InChI=1/C5H8N4/c1-4-2-3-5(7-6)9-8-4/h2-3H,6H2,1H3,(H,7,9)

SMILES: Cc1ccc(=NN)[nH]n1

Synonyms:

• 3-Hydrazino-6-methylpyridazine
• Pyridazine, 3-Hydrazinyl-6-Methyl-

3-Methylpyridazin-6-ylhydrazine

CAS: 38956-79-5

Formula: C₅H₈N₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 124.1438

Ref: IN-DA00BZIS

3-Methylpyridazin-6-Ylhydrazine

CAS: 38956-79-5

3-Methylpyridazin-6-Ylhydrazine

Purity: 97%

Molecular weight: 124.14g/mol

Ref: 54-OR1011051

3-Hydrazino-6-methylpyridazine

CAS: 38956-79-5

Formula: C₅H₈N₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 124.147

Ref: 10-F068754