
CAS 38956-82-0
:L-Lysine, N6-[L-2-(4-carboxy-5,5-dimethyl-2-thiazolidinyl)-N-(phenylacetyl)glycyl]-N2-formyl-, calcium salt (1:1), stereoisomer
Description:
L-Lysine, N6-[L-2-(4-carboxy-5,5-dimethyl-2-thiazolidinyl)-N-(phenylacetyl)glycyl]-N2-formyl-, calcium salt (1:1), stereoisomer, is a complex organic compound that features a lysine backbone modified with various functional groups, including a thiazolidine ring and a phenylacetyl moiety. This compound is characterized by its calcium salt form, which enhances its solubility and stability in biological systems. The presence of multiple functional groups suggests potential biological activity, possibly as a pharmaceutical agent or a biochemical probe. The stereoisomer designation indicates that the compound can exist in different spatial arrangements, which may influence its biological interactions and efficacy. Generally, compounds like this are studied for their roles in metabolic pathways, potential therapeutic applications, and interactions with biological macromolecules. As with many amino acid derivatives, it may exhibit properties such as being a zwitterion at physiological pH, contributing to its solubility and reactivity in aqueous environments. Further investigation into its specific properties and applications would require empirical studies and characterization techniques.
Formula:C23H32N4O7S·Ca
InChI:InChI=1S/C23H32N4O7S.Ca/c1-23(2)18(22(33)34)27-20(35-23)17(26-16(29)12-14-8-4-3-5-9-14)19(30)24-11-7-6-10-15(21(31)32)25-13-28;/h3-5,8-9,13,15,17-18,20,27H,6-7,10-12H2,1-2H3,(H,24,30)(H,25,28)(H,26,29)(H,31,32)(H,33,34);
InChI key:InChIKey=XXARWTMPIFIROT-UHFFFAOYSA-N
SMILES:C(NC(CC1=CC=CC=C1)=O)(C(NCCCCC(NC=O)C(O)=O)=O)C2NC(C(O)=O)C(C)(C)S2.[Ca]
Synonyms:- N6-(Benzyl-α-penicilloyl)-N2-formyl-L-lysine calcium
- L-Lysine, N6-[L-2-(4-carboxy-5,5-dimethyl-2-thiazolidinyl)-N-(phenylacetyl)glycyl]-N2-formyl-, calcium salt (1:1), stereoisomer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzylpenicilloylformyllysine
CAS:Benzylpenicilloylformyllysine is a synthetic penicilloyl hapten.Formula:C23H34CaN4O7SColor and Shape:SolidMolecular weight:550.68
