CAS 389621-80-1
:4-(N,N-Diethylaminocarbonyl)phenylboronic acid
Description:
4-(N,N-Diethylaminocarbonyl)phenylboronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring, which is further substituted with a diethylaminocarbonyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the boronic acid and amine functionalities. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and as a reagent in chemical biology. The diethylamino group contributes to the compound's basicity and can influence its reactivity and interaction with other molecules. Additionally, the compound may exhibit specific optical properties, depending on its molecular structure and environment. Overall, 4-(N,N-Diethylaminocarbonyl)phenylboronic acid is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C11H16BNO3
InChI:InChI=1/C11H16BNO3/c1-3-13(4-2)11(14)9-5-7-10(8-6-9)12(15)16/h5-8,15-16H,3-4H2,1-2H3
Synonyms:- 4-(Diethylcarbamoyl)phenylboronic acid
- [4-(Diethylcarbamoyl)Phenyl]Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Diethylcarbamoyl)benzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H16BNO3Purity:98%Molecular weight:221.064-(N,N-Diethylaminocarbonyl)phenylboronic acid
CAS:Formula:C11H16BNO3Purity:95%Color and Shape:SolidMolecular weight:221.06064-(Diethylcarbamoyl)benzeneboronic acid
CAS:4-(Diethylcarbamoyl)benzeneboronic acidFormula:C11H16BNO3Purity:98%Color and Shape: white solidMolecular weight:221.06g/mol4-(Diethylcarbamoyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C11H16BNO3Color and Shape:White to Almost white powder to crystalMolecular weight:221.064-(N,N-Diethylaminocarbonyl)phenylboronic acid
CAS:Formula:C11H16BNO3Purity:98%Color and Shape:SolidMolecular weight:221.06




