CAS 389621-81-2
:4-(Pyrrolidine-1-carbonyl)phenylboronic acid
Description:
4-(Pyrrolidine-1-carbonyl)phenylboronic acid, with the CAS number 389621-81-2, is an organic compound that features a boronic acid functional group attached to a phenyl ring, which is further substituted with a pyrrolidine-1-carbonyl moiety. This compound is characterized by its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The presence of the boronic acid group allows for potential interactions in biological systems, particularly in the development of drug candidates targeting specific enzymes or receptors. Additionally, the pyrrolidine ring contributes to the compound's steric and electronic properties, influencing its reactivity and solubility. Typically, compounds like this are studied for their role in drug delivery systems, as well as in the synthesis of complex organic molecules through cross-coupling reactions. Overall, 4-(Pyrrolidine-1-carbonyl)phenylboronic acid exemplifies the versatility of boronic acids in organic synthesis and their significance in pharmaceutical research.
Formula:C11H14BNO3
InChI:InChI=1/C11H14BNO3/c14-11(13-7-1-2-8-13)9-3-5-10(6-4-9)12(15)16/h3-6,15-16H,1-2,7-8H2
SMILES:C1CCN(C1)C(=O)c1ccc(cc1)B(O)O
Synonyms:- [4-(Pyrrolidin-1-Ylcarbonyl)Phenyl]Boronic Acid
- 4-(Pyrrolidine-1-Carbonyl)Benzeneboronic Acid
- 4-(Pyrrolidine-1-carbonyl)-phenyl boronic acid:
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-[(1-Pyrrolidinyl)carbonyl]phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C11H14BNO3Purity:97.0 to 109.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:219.054-(1-Pyrrolidinylcarbonyl)benzeneboronic acid, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C11H14BNO3Purity:96%Molecular weight:219.054-Pyrrolidinylcarbonylphenylboronic acid
CAS:Formula:C11H14BNO3Purity:97%Color and Shape:SolidMolecular weight:219.04484-[(Pyrrolidin-1-yl)carbonyl]benzeneboronic acid
CAS:<p>4-[(Pyrrolidin-1-yl)carbonyl]benzeneboronic acid</p>Formula:C11H14BNO3Purity:≥95%Color and Shape: off-white to light yellow solidMolecular weight:219.04g/mol(4-(Pyrrolidine-1-carbonyl)phenyl)boronic acid
CAS:Formula:C11H14BNO3Purity:95%Color and Shape:SolidMolecular weight:219.05




