CAS 38965-77-4
:(2E)-1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-phenylprop-2-en-1-one
Description:
The chemical substance known as (2E)-1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-phenylprop-2-en-1-one, with the CAS number 38965-77-4, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as hydroxyl, methoxy, and alkenyl moieties. This compound features a phenylpropene backbone, which contributes to its potential reactivity and biological activity. It is likely to exhibit properties typical of flavonoids or related polyphenolic compounds, including antioxidant activity and potential interactions with various biological targets. The presence of the methoxy group may enhance lipophilicity, influencing its solubility and bioavailability. Additionally, the compound's structural features suggest it may participate in various chemical reactions, such as electrophilic substitutions or radical reactions. Its specific applications and effects would depend on further empirical studies, particularly in the fields of medicinal chemistry and pharmacology, where such compounds are often explored for therapeutic potential.
Formula:C21H22O3
InChI:InChI=1/C21H22O3/c1-15(2)9-11-18-20(24-3)14-12-17(21(18)23)19(22)13-10-16-7-5-4-6-8-16/h4-10,12-14,23H,11H2,1-3H3/b13-10+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
