CAS 38966-30-2

5′-Guanylic acid, calcium salt (1:?)

Description:

5′-Guanylic acid, calcium salt (CAS 38966-30-2) is a nucleotide derivative that plays a crucial role in cellular processes, particularly in signal transduction and energy metabolism. As a calcium salt of guanylic acid, it consists of a guanine base linked to a ribose sugar and a phosphate group, with calcium ions associated to balance the charge. This compound is typically white to off-white in appearance and is soluble in water, making it suitable for various biochemical applications. It is often used in research and pharmaceutical formulations due to its ability to act as a signaling molecule, influencing pathways such as cyclic GMP production. Additionally, it may exhibit properties that enhance cellular communication and metabolic regulation. The presence of calcium ions can also contribute to its stability and bioavailability in biological systems. Overall, 5′-Guanylic acid, calcium salt is significant in both fundamental research and potential therapeutic applications.

Formula: C₁₀H₁₄N₅O₈P·xCa

InChI: InChI=1S/C10H14N5O8P.Ca/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(23-9)1-22-24(19,20)21;/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18);/t3-,5-,6-,9-;/m1./s1

InChI key: InChIKey=SAQPIVLCCLICGF-GWTDSMLYSA-N

SMILES: O=C1C2=C(N(C=N2)[C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3O)NC(N)=N1.[Ca]

Synonyms:

• 5'-Guanylicacid, calcium salt (9CI)
• 5′-Guanylic acid, calcium salt
• 5′-Guanylic acid, calcium salt (1:?)
• Calcium guanylate

Guanosine 5'-monophosphate calcium salt

CAS: 38966-30-2

guanosine 5'-monophosphate calcium salt is a dietary supplement that contains calcium carbonate and guanosine 5'-monophosphate. This product is a light-exposed supplement that contains phenolic acids, polycarboxylic acids, and cyclic nucleotide phosphodiesterases. It is used to maintain ATP levels in the body. Guanosine 5'-monophosphate calcium salt should not be taken by people with a history of kidney stones or those taking other supplements containing calcium. This product may contain preservatives, excipients, or pharmaceutical ingredients for potency and stability purposes.

Formula: C₁₀H₁₂CaN₅O₈P

Purity: Min. 95%

Molecular weight: 401.28 g/mol

Ref: 3D-NG40772