CAS 3898-66-6

2-(carboxymethyl)-5-nitrobenzoic acid

Description:

2-(Carboxymethyl)-5-nitrobenzoic acid, with the CAS number 3898-66-6, is an organic compound characterized by its aromatic structure, which includes a nitro group and a carboxymethyl substituent on a benzoic acid framework. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid functional group. The nitro group contributes to its electron-withdrawing properties, influencing its reactivity and potential applications in organic synthesis. It can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in the synthesis of more complex molecules. Additionally, the presence of both carboxylic acid and nitro functionalities may impart unique properties, such as increased acidity and potential biological activity. This compound is often utilized in research settings, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex chemical entities.

Formula: C₉H₇NO₆

InChI: InChI=1/C9H7NO6/c11-8(12)3-5-1-2-6(10(15)16)4-7(5)9(13)14/h1-2,4H,3H2,(H,11,12)(H,13,14)

SMILES: c1cc(cc(c1CC(=O)O)C(=O)O)N(=O)=O

Benzeneacetic acid, 2-carboxy-4-nitro-

CAS: 3898-66-6

Formula: C₉H₇NO₆

Purity: 95%

Color and Shape: Solid

Molecular weight: 225.1550

Ref: IN-DA00CHY4

2-(Carboxymethyl)-5-nitrobenzoic acid

CAS: 3898-66-6

2-(Carboxymethyl)-5-nitrobenzoic acid

Purity: 97%

Molecular weight: 225.15g/mol

Ref: 54-OR94904

2-(carboxymethyl)-5-nitrobenzoic acid

CAS: 3898-66-6

Formula: C₉H₇NO₆

Purity: 95%

Color and Shape: Solid

Molecular weight: 225.156

Ref: 10-F526964