CAS 38989-32-1

3-[(2,4-dimethoxyphenyl)amino]-3-oxopropanoic acid

Description:

3-[(2,4-Dimethoxyphenyl)amino]-3-oxopropanoic acid, with the CAS number 38989-32-1, is an organic compound characterized by its unique structure that includes an amino group, a ketone, and a carboxylic acid functional group. This compound features a 2,4-dimethoxyphenyl group, which contributes to its aromatic properties and potential biological activity. The presence of the amino group suggests that it may participate in various chemical reactions, such as forming amides or engaging in nucleophilic substitutions. The carboxylic acid group indicates that it can act as an acid, capable of donating protons in solution, while the ketone functionality may influence its reactivity and stability. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature, which are important considerations for its application in research and industry.

Formula: C₁₁H₁₃NO₅

InChI: InChI=1/C11H13NO5/c1-16-7-3-4-8(9(5-7)17-2)12-10(13)6-11(14)15/h3-5H,6H2,1-2H3,(H,12,13)(H,14,15)

SMILES: COc1ccc(c(c1)OC)N=C(CC(=O)O)O

Synonyms:

• Propanoic Acid, 3-[(2,4-Dimethoxyphenyl)Amino]-3-Oxo-

3-[(2,4-dimethoxyphenyl)amino]-3-oxopropanoic acid

CAS: 38989-32-1

Formula: C₁₁H₁₃NO₅

Purity: 95.0%

Molecular weight: 239.227

Ref: 10-F310158