CAS 38998-04-8

7-methoxy-2,3-dihydro-1H-inden-4-ol

Description:

7-Methoxy-2,3-dihydro-1H-inden-4-ol, with the CAS number 38998-04-8, is an organic compound characterized by its bicyclic structure, which includes an indene framework. This compound features a methoxy group (-OCH3) at the 7-position and a hydroxyl group (-OH) at the 4-position, contributing to its reactivity and potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxyl group suggests that it can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the methoxy group can enhance lipophilicity, affecting its interaction with biological membranes. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it may be studied for its potential applications in drug development or as a chemical intermediate. As with many organic compounds, safety data should be consulted for handling and usage.

Formula: C₁₀H₁₂O₂

InChI: InChI=1/C10H12O2/c1-12-10-6-5-9(11)7-3-2-4-8(7)10/h5-6,11H,2-4H2,1H3

SMILES: COc1ccc(c2CCCc12)O

4-Hydroxy-7-methoxyindane

CAS: 38998-04-8

4-Hydroxy-7-methoxyindane

Formula: C₁₀H₁₂O₂

Purity: ≥95%

Color and Shape: solid

Molecular weight: 164.20g/mol

Ref: 54-OR11192