CAS 3900-93-4: 2-Cyclopentyl-2-phenylacetic acid
Description:2-Cyclopentyl-2-phenylacetic acid is an organic compound characterized by its unique structure, which features a cyclopentyl group and a phenyl group attached to a central acetic acid moiety. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic characteristics. The presence of both cyclopentyl and phenyl groups contributes to its potential as a lipophilic compound, which may influence its biological activity and interactions in various chemical environments. The acid functional group allows for potential reactivity, including esterification and salt formation, making it useful in synthetic organic chemistry. Additionally, 2-Cyclopentyl-2-phenylacetic acid may exhibit interesting pharmacological properties, although specific biological activities would depend on further research and context. As with many organic acids, it is important to handle this compound with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C13H16O2
InChI:InChI=1S/C13H16O2/c14-13(15)12(11-8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,11-12H,4-5,8-9H2,(H,14,15)
InChI key:InChIKey=BCJIDGDYYYBNNB-UHFFFAOYSA-N
SMILES:O=C(O)C(C=1C=CC=CC1)C2CCCC2
- Synonyms:
- (2R)-cyclopentyl(phenyl)ethanoate
- (2R)-cyclopentyl(phenyl)ethanoic acid
- (2S)-cyclopentyl(phenyl)ethanoate
- 2-Cyclopentyl-2-phenylacetic acid
- <span class="text-smallcaps">A</span>-Cyclopentylbenzeneacetic acid
- Acetic acid, cyclopentylphenyl-
- Benzeneacetic acid, α-cyclopentyl-
- Cyclopentaneacetic acid, α-phenyl-
- Cyclopentyl(Phenyl)Acetic Acid
- Cyclopentylphenylacetic acid
- See more synonyms
- NSC 68311
- alpha-Cyclopentylphenylacetic acid
- alpha-Phenylcyclopentylacetic acid
- α-Cyclopentylbenzeneacetic acid
- α-Phenylcyclopentaneacetic acid
