CAS 39012-01-6

5,7-dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-chromen-4-one

Description:

5,7-Dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-chromen-4-one, also known by its CAS number 39012-01-6, is a flavonoid compound characterized by its chromone backbone, which is a fused benzopyran structure. This compound features multiple hydroxyl (-OH) groups and methoxy (-OCH3) substituents, contributing to its potential antioxidant properties. The presence of these functional groups enhances its solubility and reactivity, making it of interest in various biological and pharmacological studies. Flavonoids like this compound are known for their ability to scavenge free radicals, which may provide protective effects against oxidative stress. Additionally, the structural features suggest potential interactions with biological targets, making it a candidate for research in areas such as cancer prevention, anti-inflammatory effects, and cardiovascular health. Its specific characteristics, including melting point, solubility, and spectral data, would typically be determined through experimental methods and may vary based on the conditions of the study.

Formula: C₁₇H₁₄O₇

InChI: InChI=1/C17H14O7/c1-22-12-5-8(3-4-10(12)18)9-7-24-13-6-11(19)17(23-2)16(21)14(13)15(9)20/h3-7,18-19,21H,1-2H3

SMILES: COc1cc(ccc1O)c1coc2cc(c(c(c2c1=O)O)OC)O

Synonyms:

• 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-6-methoxy-
• 5,7-Dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one

3',6-Dimethoxy-4',5,7-trihydroxyisoflavone

CAS: 39012-01-6

Formula: C₁₇H₁₄O₇

Purity: 98.0%

Molecular weight: 330.2889

Ref: IN-DA00CHM7

Iristectorigenin A

CAS: 39012-01-6

Iristectorigenin A

Purity: ≥98%

Molecular weight: 330.29g/mol

Ref: 54-BUP03118

Iristectorigenin A

CAS: 39012-01-6

Formula: C₁₇H₁₄O₇

Molecular weight: 330.29

Ref: 7W-GY9529

Iristectorigenin A

CAS: 39012-01-6

Formula: C₁₇H₁₄O₇

Purity: 95%~99%

Color and Shape: 射干

Molecular weight: 330.292

Ref: BP-BP4179

Iristectorigenin A

CAS: 39012-01-6

Iristectorigenin A is a natural isoflavone isolated from B. chinensis rhizomes with antioxidant activity.

Formula: C₁₇H₁₄O₇

Purity: 99.9% - 99.97%

Color and Shape: Solid

Molecular weight: 330.29

Ref: TM-TN2357

Iristectorigenin A

CAS: 39012-01-6

Iristectorigenin A is a naturally occurring isoflavone compound, which is derived from the rhizomes of the Iris plant species, particularly Iris tectorum. As a bioactive flavonoid, it exhibits multiple pharmacological activities owing to its chemical structure. The compound operates primarily by modulating various biochemical pathways, including antioxidant, anti-inflammatory, and potential anti-cancer pathways. This modulation is facilitated by its ability to interact with cellular signaling molecules and enzyme systems, such as cyclooxygenase and lipoxygenase, which are involved in inflammatory processes. Additionally, it has shown potential in inhibiting certain tumor cell lines, suggesting its role in the regulation of cell growth and apoptosis.

Formula: C₁₇H₁₄O₇

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 330.29 g/mol

Ref: 3D-FI74508