CAS 39012-04-9: 3-[(6-deoxy-alpha-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
Description:The chemical substance known as 3-[(6-deoxy-alpha-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside, with the CAS number 39012-04-9, is a glycosylated flavonoid compound. It features a chromen-4-one backbone, which is characteristic of flavonoids, and is substituted with various functional groups, including hydroxyl and glycosyl moieties. The presence of the 6-deoxy-alpha-L-mannopyranosyl group indicates that it has a sugar component that can influence its solubility and biological activity. The compound's structure suggests potential antioxidant properties due to the presence of hydroxyl groups, which can scavenge free radicals. Additionally, the presence of the 3-methylbut-2-en-1-yl group may enhance its lipophilicity, potentially affecting its interaction with biological membranes. Overall, this compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and natural product research.
Formula:C32H38O15
InChI:InChI=1/C32H38O15/c1-12(2)4-9-16-18(44-32-27(42)25(40)22(37)19(11-33)45-32)10-17(35)20-23(38)30(47-31-26(41)24(39)21(36)13(3)43-31)28(46-29(16)20)14-5-7-15(34)8-6-14/h4-8,10,13,19,21-22,24-27,31-37,39-42H,9,11H2,1-3H3/t13-,19+,21-,22+,24+,25-,26+,27+,31-,32+/m0/s1
- Synonyms:
- 4H-1-Benzopyran-4-one, 3-((6-deoxy-alpha-L-mannopyranosyl)oxy)-7-(beta-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-butenyl)-