CAS 39012-04-9
:3-[(6-deoxy-alpha-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
Description:
The chemical substance known as 3-[(6-deoxy-alpha-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside, with the CAS number 39012-04-9, is a glycosylated flavonoid compound. It features a chromen-4-one backbone, which is characteristic of flavonoids, and is substituted with various functional groups, including hydroxyl and glycosyl moieties. The presence of the 6-deoxy-alpha-L-mannopyranosyl group indicates that it has a sugar component that can influence its solubility and biological activity. The compound's structure suggests potential antioxidant properties due to the presence of hydroxyl groups, which can scavenge free radicals. Additionally, the presence of the 3-methylbut-2-en-1-yl group may enhance its lipophilicity, potentially affecting its interaction with biological membranes. Overall, this compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and natural product research.
Formula:C32H38O15
InChI:InChI=1/C32H38O15/c1-12(2)4-9-16-18(44-32-27(42)25(40)22(37)19(11-33)45-32)10-17(35)20-23(38)30(47-31-26(41)24(39)21(36)13(3)43-31)28(46-29(16)20)14-5-7-15(34)8-6-14/h4-8,10,13,19,21-22,24-27,31-37,39-42H,9,11H2,1-3H3/t13-,19+,21-,22+,24+,25-,26+,27+,31-,32+/m0/s1
Synonyms:- 4H-1-Benzopyran-4-one, 3-((6-deoxy-alpha-L-mannopyranosyl)oxy)-7-(beta-D-glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-butenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Epimedoside A
CAS:<p>Epimedoside A has significant antioxidant activity in vitro.</p>Formula:C32H38O15Purity:98.94% - 99.67%Color and Shape:SolidMolecular weight:662.64Epimedoside A
CAS:<p>Epimedoside A is a glycoside compound, which is a secondary metabolite derived from the Epimedium plant, commonly known as "horny goat weed." This glycoside is sourced from plants in the Berberidaceae family, which are native to various regions in Asia. Epimedoside A exhibits its mode of action through several biochemical pathways, including the modulation of enzyme activity and receptor interactions that are linked to various physiological effects.</p>Purity:Min. 95%






