CAS 39025-24-6
:(-)-(E)-Guggulsterone
Description:
(-)-(E)-Guggulsterone, with the CAS number 39025-24-6, is a naturally occurring steroidal compound derived from the resin of the Commiphora mukul tree, commonly known as guggul. This compound is characterized by its dual isomeric forms, with the (-)-(E) configuration being biologically active. Guggulsterone is known for its potential therapeutic properties, particularly in traditional medicine, where it has been used for its anti-inflammatory and lipid-lowering effects. Chemically, it features a steroid backbone with specific functional groups that contribute to its biological activity. The compound has garnered interest in pharmacological research for its role in modulating cholesterol levels and its potential effects on metabolic disorders. Additionally, guggulsterone has been studied for its possible anticancer properties and its influence on thyroid function. Its solubility and stability can vary depending on the formulation, which is important for its application in dietary supplements and herbal remedies. Overall, (-)-(E)-Guggulsterone represents a significant compound in both traditional and modern medicinal contexts.
Formula:C21H28O2
InChI:InChI=1S/C21H28O2/c1-4-16-19(23)12-18-15-6-5-13-11-14(22)7-9-20(13,2)17(15)8-10-21(16,18)3/h4,11,15,17-18H,5-10,12H2,1-3H3/b16-4-/t15-,17+,18+,20+,21-/m1/s1
InChI key:InChIKey=WDXRGPWQVHZTQJ-AUKWTSKRSA-N
SMILES:C[C@@]1/2[C@]([C@]3([C@@]([C@]4(C)C(CC3)=CC(=O)CC4)(CC1)[H])[H])(CC(=O)\C2=C\C)[H]
Synonyms:- (-)-(E)-Guggulsterone
- (17E)-Pregna-4,17(20)-diene-3,16-dione
- (17E)-pregna-4,17-diene-3,16-dione
- 4,17(20)-(trans)-Pregnadiene-3,16-dione
- E-Guggulsteron
- Guggulsterone E
- trans-Guggulsterone
- Pregna-4,17(20)-diene-3,16-dione, (17E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Pregna-4,17(20)-diene-3,16-dione, (17E)-
CAS:Formula:C21H28O2Purity:98%Color and Shape:SolidMolecular weight:312.4458(E)-Guggulsterone
CAS:Formula:C21H28O2Purity:≥ 95.0%Color and Shape:White to off-white powderMolecular weight:312.45(E)-Guggulsterone
CAS:Bile acids aid fat digestion, originate from cholesterol, activate FXR, and can be toxic. Guggulsterone inhibits FXR and lowers rodent cholesterol.
Formula:C21H28O2Color and Shape:SolidMolecular weight:312.45Guggulsterone e
CAS:Alicyclic ketoneFormula:C21H28O2Purity:≥ 90.0 % (HPLC)Color and Shape:CrystalsMolecular weight:312.45(E)-Guggulsterone
CAS:Controlled Product(E)-Guggulsterone is a phytosteroid, which is a bioactive compound derived from the resin of the Commiphora mukul tree, commonly known as the guggul plant. Its mode of action primarily involves antagonism of the farnesoid X receptor (FXR), a bile acid receptor, which plays a crucial role in cholesterol metabolism and bile acid homeostasis. By inhibiting FXR, (E)-Guggulsterone increases the conversion of cholesterol to bile acids, thus promoting the reduction of cholesterol levels.Formula:C21H28O2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:312.45 g/mol(E)-Guggulsterone
CAS:Controlled ProductApplications (E)-Guggulsterone acts as an α-glucosidase inhibitor also known as a hypolipidemic agent.
References Yang, D. et al.: J. Lipid Res., 53, 529 (2012); El-Mekkawy, S. et al.: Nat. Prod. Res., 27, 146 (2013);Formula:C21H28O2Color and Shape:White To Off-WhiteMolecular weight:312.45







