CymitQuimica logo

CAS 390427-07-3

:

Carbamic acid, [(2-hydroxyphenyl)methyl]-, 1,1-dimethylethyl ester

Description:
Carbamic acid, [(2-hydroxyphenyl)methyl]-, 1,1-dimethylethyl ester, identified by CAS number 390427-07-3, is an organic compound characterized by its carbamate functional group. This substance features a phenolic moiety, specifically a 2-hydroxyphenyl group, which contributes to its potential biological activity and solubility properties. The presence of the tert-butyl ester group enhances its stability and lipophilicity, making it suitable for various applications in organic synthesis and potentially in pharmaceuticals. The compound may exhibit moderate to high polarity due to the hydroxyl group, influencing its interaction with biological systems. Additionally, the structural arrangement suggests potential for hydrogen bonding, which can affect its reactivity and solubility in different solvents. As with many carbamates, it may also possess insecticidal or herbicidal properties, depending on its specific structure and substituents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.
Formula:C12H17NO3
InChI:InChI=1S/C12H17NO3/c1-12(2,3)16-11(15)13-8-9-6-4-5-7-10(9)14/h4-7,14H,8H2,1-3H3,(H,13,15)
InChI key:SAIZFIRMLDAPKH-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NCC1=CC=CC=C1O
Found 4 products.