CAS 3906-55-6
:Nickel cyclohexanebutyrate
Description:
Nickel cyclohexanebutyrate, with the CAS number 3906-55-6, is a coordination compound that features nickel as the central metal ion coordinated to cyclohexanebutyrate ligands. This compound typically exhibits characteristics associated with transition metal complexes, including distinct coordination geometries and potential catalytic properties. Nickel, being a transition metal, can exhibit multiple oxidation states, although in this compound, it is usually in the +2 oxidation state. The cyclohexanebutyrate ligands contribute to the overall stability and solubility of the complex, often enhancing its reactivity in various chemical processes. Nickel cyclohexanebutyrate may be utilized in organic synthesis, catalysis, and materials science due to its unique properties. Additionally, the compound's behavior in solution can be influenced by factors such as pH, temperature, and the presence of other ions or solvents. Safety data should be consulted, as nickel compounds can pose health risks, and appropriate handling and disposal measures should be observed in laboratory settings.
Formula:C10H18O2Ni
InChI:InChI=1S/C10H18O2.Ni/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h9H,1-8H2,(H,11,12);
InChI key:InChIKey=ZTHUTUTZMKFHJM-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)C1CCCCC1.[Ni]
Synonyms:- Cyclohexanebutanoic acid, nickel(2+) salt (2:1)
- Cyclohexanebutyric acid, nickel salt
- Nsc 7729
- Nickel 4-cyclohexylbutyrate
- Nickel cyclohexanebutyrate
- Nickel cyclohexylbutyrate
- Nickel(II) 4-cyclohexylbutyrate
- Cyclohexanebutanoic acid, nickel(2+) salt
- Nickel(2+) Bis(4-Cyclohexylbutanoate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
