CAS 39062-63-0
:Benzoic acid, 2-chloro-5-hydroxy-, ethyl ester
Description:
Benzoic acid, 2-chloro-5-hydroxy-, ethyl ester, with the CAS number 39062-63-0, is an organic compound characterized by its ester functional group derived from benzoic acid. This compound features a benzoic acid backbone with a chlorine atom and a hydroxyl group positioned at the 2 and 5 positions, respectively, on the aromatic ring, while the ethyl ester group is attached to the carboxylic acid. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the chlorine atom contributes to its reactivity, making it useful in various chemical syntheses and applications. The hydroxyl group can participate in hydrogen bonding, influencing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. As with many chlorinated compounds, it is essential to handle it with care due to potential environmental and health impacts. Proper safety measures should be observed when working with this substance in laboratory or industrial settings.
Formula:C9H9ClO3
InChI:InChI=1/C9H9ClO3/c1-2-13-9(12)7-5-6(11)3-4-8(7)10/h3-5,11H,2H2,1H3
SMILES:CCOC(=O)c1cc(ccc1Cl)O
Synonyms:- Ethyl 2-chloro-5-hydroxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Chloro-5-hydroxybenzoic acid ethyl ester
CAS:2-Chloro-5-hydroxybenzoic acid ethyl ester is synthesized by the substitution of anthranilic acid with an aryl ring. The substituents on the aryl ring are chloro and hydroxy, which are attached to carbon atoms. 2-Chloro-5-hydroxybenzoic acid ethyl ester can be metabolized into a number of different metabolites. For example, it can be converted into acid metabolites that have substituents on the benzene ring such as nitro or nitroso groups. These metabolites are then excreted in urine or bile.Formula:C9H9ClO3Purity:Min. 95%Color and Shape:Off-White To Yellow To Brown SolidMolecular weight:200.62 g/mol


