CAS 39067-80-6
:Thiogeraniol
Description:
Thiogeraniol, with the CAS number 39067-80-6, is an organosulfur compound characterized by its unique structure, which includes a thiol group (-SH) attached to a geraniol backbone. This compound is known for its pleasant, floral aroma, making it of interest in the fragrance and flavor industries. Thiogeraniol exhibits properties typical of thiols, such as being a polar molecule with the ability to form hydrogen bonds, which can influence its solubility in various solvents. It is generally less stable than its alcohol counterpart, geraniol, due to the presence of the sulfur atom, which can participate in various chemical reactions, including oxidation. Additionally, thiogeraniol may possess antioxidant properties, contributing to its potential applications in cosmetics and food preservation. Safety data indicates that, like many thiols, it should be handled with care due to potential irritant effects. Overall, thiogeraniol is a versatile compound with applications in multiple fields, particularly in the formulation of scented products.
Formula:C10H18S
InChI:InChI=1S/C10H18S/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+
InChI key:InChIKey=FACAUSJJVBMWLV-JXMROGBWSA-N
SMILES:C(\CCC=C(C)C)(=C/CS)/C
Synonyms:- (2E)-3,7-Dimethyl-2,6-octadiene-1-thiol
- (2Z)-3,7-dimethylocta-2,6-diene-1-thiol
- (E)-3,7-Dimethylocta-2,6-dienylmercaptan
- 2,6-Octadiene-1-thiol, 3,7-dimethyl-, (2E)-
- 2,6-Octadiene-1-thiol, 3,7-dimethyl-, (E)-
- 2,6-octadiene-1-thiol, 3,7-dimethyl-,(2Z)-
- 2-Trans-3,7-dimethyl-2,6-octadien-1-mercaptan
- 3,7-Dimethyl-2,6-octadien-1-thiol
- Geranyl mercaptan
- Thiogeraniol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Thiogeraniol
CAS:<p>Thiogeraniol is a dibutyl, caproic acid and fatty acid that belongs to the group of terpenes. It has antioxidative properties, which have been shown to prevent cavities in rats. Thiogeraniol also has an acidic pH of 2.5, which may be due to its hydroxyl group and structural formula. This compound may also have antioxidant properties due to its hydroxyl group and structural formula. Thiogeraniol has been shown to inhibit oxidative DNA damage in rats by increasing glutathione levels and inhibiting lipid peroxidation.</p>Formula:C10H18SColor and Shape:Clear LiquidMolecular weight:170.32 g/mol
