CAS 39069-52-8: N,N'-dicyclopentyl-2-(methylsulfanyl)-5-nitropyrimidine-4,6-diamine
Description:N,N'-Dicyclopentyl-2-(methylsulfanyl)-5-nitropyrimidine-4,6-diamine, with the CAS number 39069-52-8, is a chemical compound characterized by its complex structure, which includes a pyrimidine ring substituted with various functional groups. The presence of two cyclopentyl groups contributes to its hydrophobic characteristics, while the methylsulfanyl group introduces a sulfur atom, enhancing its potential for specific interactions in biological systems. The nitro group at the 5-position of the pyrimidine ring may impart unique reactivity and influence the compound's electronic properties. This compound is likely to exhibit moderate to low solubility in water due to its bulky cyclopentyl substituents, but it may dissolve in organic solvents. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses.
Formula:C15H23N5O2S
InChI:InChI=1S/C15H23N5O2S/c1-23-15-18-13(16-10-6-2-3-7-10)12(20(21)22)14(19-15)17-11-8-4-5-9-11/h10-11H,2-9H2,1H3,(H2,16,17,18,19)
InChI key:InChIKey=GSGVDKOCBKBMGG-UHFFFAOYSA-N
SMILES:O=N(=O)C=1C(=NC(=NC1NC2CCCC2)SC)NC3CCCC3
- Synonyms:
- 4,6-Pyrimidinediamine, N,N′-dicyclopentyl-2-(methylthio)-5-nitro-
- 4,6-Pyrimidinediamine, N<sup>4</sup>,N<sup>6</sup>-dicyclopentyl-2-(methylthio)-5-nitro-
- 4,6-Pyrimidinediamine, N~4~,N~6~-dicyclopentyl-2-(methylthio)-5-nitro-
- Gs 39783
- N,N'-dicyclopentyl-2-methylsulfanyl-5-nitro-pyrimidine-4,6-diamine
- N<sup>4</sup>,N<sup>6</sup>-Dicyclopentyl-2-(methylthio)-5-nitro-4,6-pyrimidinediamine
