CAS 39072-28-1

2-thiophen-2-ylquinoline-4-carbohydrazide

Description:

2-Thiophen-2-ylquinoline-4-carbohydrazide is an organic compound characterized by its unique structure, which combines a quinoline moiety with a thiophene ring and a hydrazide functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. The presence of the thiophene and quinoline rings suggests possible applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents. The hydrazide functional group may also contribute to its reactivity, allowing for further chemical modifications. Additionally, compounds like this often display interesting optical properties, which can be explored for applications in materials science. Overall, 2-thiophen-2-ylquinoline-4-carbohydrazide represents a versatile scaffold for further research and development in various chemical and biological fields.

Formula: C₁₄H₁₁N₃OS

InChI: InChI=1/C14H11N3OS/c15-17-14(18)10-8-12(13-6-3-7-19-13)16-11-5-2-1-4-9(10)11/h1-8H,15H2,(H,17,18)

SMILES: c1ccc2c(c1)c(cc(c1cccs1)n2)C(=NN)O

Synonyms:

• 2-(2-Thienyl)quinoline-4-carbohydrazide
• 2-(Thiophen-2-Yl)Quinoline-4-Carbohydrazide
• 2-Thiophen-2-Yl-Quinoline-4-Carboxylic Acid Hydrazide
• 4-Quinolinecarboxylic acid, 2-(2-thienyl)-, hydrazide