
CAS 39079-62-4
:Chromone-3-carboxylic acid
Description:
Chromone-3-carboxylic acid is an organic compound characterized by its chromone backbone, which is a fused benzopyran structure. This compound features a carboxylic acid functional group at the 3-position of the chromone ring, contributing to its acidic properties. Chromone derivatives are known for their diverse biological activities, including anti-inflammatory, antioxidant, and antimicrobial effects. The presence of the carboxylic acid group enhances its solubility in polar solvents and can facilitate interactions with biological targets. Chromone-3-carboxylic acid may also participate in various chemical reactions, such as esterification and amidation, making it a versatile intermediate in organic synthesis. Its structural features allow for potential modifications that can lead to the development of novel pharmaceuticals or agrochemicals. Overall, this compound exemplifies the significance of chromone derivatives in medicinal chemistry and their potential applications in various fields.
Formula:C10H5O4
InChI:InChI=1/C10H6O4/c11-9-6-3-1-2-4-8(6)14-5-7(9)10(12)13/h1-5H,(H,12,13)/p-1
SMILES:c1ccc2c(c1)c(=O)c(co2)C(=O)[O-]
Synonyms:- 4-Oxo-4H-1-benzopyran-3-carboxylic acid
- 4-oxo-4H-chromene-3-carboxylic acid
- 4-oxo-4H-chromene-3-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Chromone-3-carboxylic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H5O4Purity:98%Color and Shape:Crystals or powder or crystalline powder, Pale cream to creamMolecular weight:189.15Chromone-3-carboxylic Acid
CAS:Formula:C10H6O4Purity:95%Color and Shape:SolidMolecular weight:190.1522Chromone-3-carboxylic acid
CAS:Chromone-3-carboxylic acidPurity:95%Color and Shape:SolidMolecular weight:190.15g/molChromone-3-carboxylic Acid
CAS:Formula:C10H6O4Purity:>98.0%(GC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:190.15Chromone-3-carboxylic Acid
CAS:Controlled ProductApplications Chromone-3-carboxylic Acid (cas# 39079-62-4) is a useful research chemical.
Formula:C10H6O4Color and Shape:NeatMolecular weight:190.15






