CAS 390824-20-1
:(5Z,8Z,11Z,14Z)-N-(3-Furanylmethyl)-5,8,11,14-eicosatetraenamide
Description:
(5Z,8Z,11Z,14Z)-N-(3-Furanylmethyl)-5,8,11,14-eicosatetraenamide is a synthetic compound characterized by its long carbon chain and multiple double bonds, specifically four cis-configured double bonds at the 5, 8, 11, and 14 positions. The presence of the furan ring, a five-membered aromatic structure containing oxygen, contributes to its unique chemical reactivity and potential biological activity. This compound is likely to exhibit amphiphilic properties due to its hydrophobic carbon chain and polar furan moiety, which may influence its solubility in various solvents and its interaction with biological membranes. The eicosatetraenamide structure suggests potential applications in biochemistry and pharmacology, particularly in studies related to lipid metabolism or as a precursor for bioactive lipids. Its specific stereochemistry and functional groups may also play a role in its biological activity, making it a subject of interest for further research in medicinal chemistry and related fields.
Formula:C25H37NO2
InChI:InChI=1S/C25H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(27)26-22-24-20-21-28-23-24/h6-7,9-10,12-13,15-16,20-21,23H,2-5,8,11,14,17-19,22H2,1H3,(H,26,27)/b7-6-,10-9-,13-12-,16-15-
InChI key:InChIKey=FZNNBSHTNRBBBD-DOFZRALJSA-N
SMILES:C(NC(CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC)=O)C=1C=COC1
Synonyms:- (5Z,8Z,11Z,14Z)-N-(3-Furanylmethyl)-5,8,11,14-eicosatetraenamide
- 5,8,11,14-Eicosatetraenamide, N-(3-furanylmethyl)-, (5Z,8Z,11Z,14Z)-
- N-(Fur-3-ylmethyl)arachidonamide
- Ucm-707
