CAS 3909-12-4: (2S,3R)-2,3,4-trihydroxybutanoic acid

Description:(2S,3R)-2,3,4-trihydroxybutanoic acid, commonly known as L-threonic acid, is a naturally occurring organic compound characterized by its structure as a four-carbon dicarboxylic acid with three hydroxyl groups. This compound is a stereoisomer, specifically one of the two enantiomers of threonic acid, with specific configurations at the second and third carbon atoms. It is a white, crystalline solid that is soluble in water due to its multiple hydroxyl groups, which enhance its polarity. L-threonic acid is known for its role in biological systems, particularly as a metabolite of vitamin C (ascorbic acid) and is involved in various biochemical pathways. Its presence in certain fruits and vegetables contributes to its nutritional significance. Additionally, it has potential applications in the food and pharmaceutical industries, particularly as a stabilizing agent or in formulations requiring antioxidant properties. The compound's ability to form hydrogen bonds due to its hydroxyl groups also contributes to its reactivity and interactions in various chemical environments.

Formula:C₄H₈O₅

InChI:InChI=1/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/t2-,3+/s2

InChI key:InChIKey=JPIJQSOTBSSVTP-FGNFWGHYNA-N

SMILES:O=C(O)C(O)C(O)CO