CymitQuimica logo

CAS 39091-00-4

:

Ethyl 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxylate

Description:
Ethyl 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxylate, with the CAS number 39091-00-4, is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The thiazole ring contributes to its biological activity, making it of interest in medicinal chemistry, particularly for its potential pharmacological properties. The ethyl ester group enhances its lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, the presence of the methyl and pyridine substituents may affect its electronic properties and reactivity. Overall, this compound is a representative example of a thiazole derivative that may be explored for various applications in drug development and organic synthesis.
Formula:C12H12N2O2S
InChI:InChI=1S/C12H12N2O2S/c1-3-16-12(15)10-8(2)14-11(17-10)9-5-4-6-13-7-9/h4-7H,3H2,1-2H3
InChI key:PNJYSPUXYJWHJJ-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(N=C(S1)C2=CN=CC=C2)C
Synonyms:
  • 5-Thiazolecarboxylicacid, 4-methyl-2-(3-pyridinyl)-, ethyl ester
Found 2 products.