CAS 39091-64-0

Propane-1,1,1,3,3,3-d6, 2-iodo-

Description:

Propane-1,1,1,3,3,3-d6, 2-iodo- is a deuterated derivative of propane, where specific hydrogen atoms are replaced with deuterium, a stable isotope of hydrogen. This compound features a propane backbone with an iodine atom substituted at the second carbon position. The presence of deuterium enhances its stability and alters its physical properties, making it useful in various applications, including NMR spectroscopy and tracer studies in chemical research. The deuteration can affect the compound's reactivity and interaction with other substances, often leading to slower reaction rates compared to its non-deuterated counterparts. Additionally, the iodine substituent introduces unique reactivity patterns, making it a valuable intermediate in organic synthesis. The compound is typically handled with standard safety precautions due to the presence of iodine, which can be hazardous in certain forms. Overall, Propane-1,1,1,3,3,3-d6, 2-iodo- serves as an important tool in both academic and industrial chemistry for studying reaction mechanisms and molecular behavior.

Formula: C₃HD₆I

InChI: InChI=1S/C3H7I/c1-3(2)4/h3H,1-2H3/i1D3,2D3

InChI key: InChIKey=FMKOJHQHASLBPH-WFGJKAKNSA-N

SMILES: C(C([2H])([2H])[2H])(C([2H])([2H])[2H])I

Synonyms:

• 1,1,1,3,3,3-Hexadeutero-2-iodopropane
• 2-Iodopropane-1,1,1,3,3,3-d₆
• Propane-1,1,1,3,3,3-d₆, 2-iodo-
• Propane-1,1,1,3,3,3-d6, 2-iodo-
• 2-Iodopropane-1,1,1,3,3,3-d6

2-Iodopropane-1,1,1,3,3,3-d6

CAS: 39091-64-0

Formula: (CD₃)₂CHI

Purity: 98 atom % D

Color and Shape: Colourless-Pale Yellow Liquid

Molecular weight: 175.99691

Ref: 3U-D0369

2-Iodopropane-1,1,1,3,3,3-d6

Controlled Product

CAS: 39091-64-0

Applications 2-Iodopropane-1,1,1,3,3,3-d6 (CAS# 39091-64-0) is a useful isotopically labeled research compound.

Formula: C₃HD₆I

Color and Shape: Neat

Molecular weight: 176.03

Ref: TR-I718801