
CAS 39099-98-4
:Methyl (2E)-3-[2-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]-2-propenoate
Description:
Methyl (2E)-3-[2-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]-2-propenoate, with CAS number 39099-98-4, is an organic compound characterized by its complex structure, which includes a methoxy group, a propenoate moiety, and a hydroxy-alkylamino side chain. This compound features a double bond in the propenoate part, indicating it can participate in various chemical reactions, such as polymerization or addition reactions. The presence of the hydroxy group suggests potential for hydrogen bonding, which may influence its solubility and reactivity in polar solvents. Additionally, the isopropylamino group contributes to its basicity and may affect its biological activity, making it of interest in pharmaceutical applications. The compound's structural features suggest it could be involved in interactions with biological systems, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Overall, its unique combination of functional groups positions it as a versatile compound in organic synthesis and medicinal chemistry.
Formula:C16H23NO4
InChI:InChI=1/C16H23NO4/c1-12(2)17-10-14(18)11-21-15-7-5-4-6-13(15)8-9-16(19)20-3/h4-9,12,14,17-18H,10-11H2,1-3H3/b9-8+
InChI key:InChIKey=LWRSDAUWAOJRPA-CMDGGOBGNA-N
SMILES:O(CC(CNC(C)C)O)C1=C(/C=C/C(OC)=O)C=CC=C1
Synonyms:- Methyl (2E)-3-[2-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]-2-propenoate
- Cinamolol
- 2-Propenoic acid, 3-[2-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]-, methyl ester, (2E)-
- 2-Propenoic acid, 3-[2-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]-, methyl ester, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cinamolol
CAS:Cinamolol is a beta blocker.Formula:C16H23NO4Color and Shape:SolidMolecular weight:293.36
