CAS 39115-94-1

3-Iodobenzhydrazide

Description:

3-Iodobenzhydrazide is an organic compound characterized by the presence of a hydrazide functional group attached to a benzene ring that is substituted with an iodine atom at the meta position. Its molecular structure consists of a benzhydrazide framework, which contributes to its reactivity and potential applications in various chemical reactions. The compound typically appears as a solid and is known for its moderate solubility in organic solvents. 3-Iodobenzhydrazide can participate in various chemical transformations, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The iodine substituent can enhance the compound's reactivity, allowing it to engage in nucleophilic substitution reactions. Additionally, the presence of the hydrazide group may impart biological activity, making it a subject of interest in medicinal chemistry. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.

Formula: C₇H₇IN₂O

InChI: InChI=1/C7H7IN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11)

SMILES: c1cc(cc(c1)I)C(=NN)O

Synonyms:

• 3-Iodobenzohydrazide

3-Iodobenzhydrazide

CAS: 39115-94-1

Formula: C₇H₇IN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 262.0478

Ref: IN-DA00C0GJ

3-Iodobenzhydrazide

CAS: 39115-94-1

3-Iodobenzhydrazide

Molecular weight: 262.04775g/mol

Ref: 54-OR1021515

3-Iodobenzhydrazide

CAS: 39115-94-1

Formula: C₇H₇IN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 262.05

Ref: 10-F018735

3-Iodobenzhydrazide

CAS: 39115-94-1

Versatile small molecule scaffold

Formula: C₇H₇IN₂O

Purity: Min. 95%

Molecular weight: 262.05 g/mol

Ref: 3D-PBA11594