CAS 39115-96-3
:3-Bromobenzoic acid hydrazide
Description:
3-Bromobenzoic acid hydrazide is an organic compound characterized by the presence of a hydrazide functional group attached to a bromobenzoic acid moiety. It typically appears as a crystalline solid and is known for its potential applications in pharmaceuticals and organic synthesis. The compound features a bromine atom substituted at the meta position of the benzoic acid ring, which can influence its reactivity and biological activity. As a hydrazide, it contains the functional group -C(=O)NH-NH2, which is known for its ability to form hydrazones and other derivatives through condensation reactions. The presence of the bromine atom may enhance the compound's electrophilicity, making it useful in various chemical reactions. Additionally, 3-Bromobenzoic acid hydrazide may exhibit specific solubility characteristics, typically being soluble in polar solvents. Its chemical properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Overall, this compound is of interest in both synthetic chemistry and medicinal chemistry research.
Formula:C7H7BrN2O
InChI:InChI=1S/C7H7BrN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11)
InChI key:InChIKey=BNAQRAZIPAHWAR-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=CC(Br)=CC=C1
Synonyms:- (3-Bromobenzoyl)hydrazine
- (m-Bromobenzoyl)hydrazine
- 3-Bromobenzohydrazide
- 3-Bromobenzoic acid hydrazide
- 3-Bromobenzoic hydrazide
- 3-Bromobenzoyl hydrazide
- 5-Bromobenzohydrazide
- Benzoic acid, 3-bromo-, hydrazide
- Benzoic acid, m-bromo-, hydrazide
- m-Bromobenzohydrazide
- m-Bromobenzoic acid hydrazide
- m-Bromobenzoic hydrazide
- m-Bromobenzoylhydrazide
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-Bromobenzohydrazide
CAS:Formula:C7H7BrN2OPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:215.053-Bromobenzhydrazide, 98+%
CAS:<p>3-Bromobenzhydrazide is used to produce 5-(3-bromo-phenyl)-3H-[1,3,4]oxadiazole-2-thione. This reaction will need reagent potassium hydroxide and solvent ethanol. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label inf</p>Formula:C7H7BrN2OPurity:98+%Color and Shape:White to pale cream to pale brown, PowderMolecular weight:215.053-Bromobenzoic hydrazide, min. 98%
CAS:Formula:C7H7BrN2OPurity:min. 98%Color and Shape:Off-white solidMolecular weight:215.053-Bromobenzhydrazide
CAS:3-BromobenzhydrazidePurity:98%Color and Shape:White SolidMolecular weight:215.05g/mol3-Bromobenzhydrazide
CAS:Formula:C7H7BrN2OPurity:98%Color and Shape:Solid, White powderMolecular weight:215.05
