CAS 3912-86-5: Tributyl-2,4-cyclopentadien-1-ylstannane

Description:Tributyl-2,4-cyclopentadien-1-ylstannane, with the CAS number 3912-86-5, is an organotin compound characterized by the presence of a cyclopentadienyl group bonded to a tin atom, which is further substituted with three butyl groups. This compound typically exhibits a low to moderate volatility and is soluble in organic solvents, making it useful in various chemical applications. The presence of the cyclopentadienyl moiety contributes to its unique reactivity and potential as a ligand in coordination chemistry. Organotin compounds like this one are often studied for their biological activity, including potential toxicity and environmental impact, as well as their utility in organic synthesis and materials science. The butyl groups enhance its hydrophobic characteristics, influencing its behavior in different chemical environments. Safety precautions are essential when handling this compound due to the potential health risks associated with organotin compounds, which can be toxic to aquatic life and may pose risks to human health.

Formula:C₁₇H₃₂Sn

InChI:InChI=1S/C5H5.3C4H9.Sn/c1-2-4-5-3-1;3*1-3-4-2;/h1-5H;3*1,3-4H2,2H3;

InChI key:InChIKey=BMSPZMQMUAKWEP-UHFFFAOYSA-N

SMILES:C=1C=CC(C1)[Sn](CCCC)(CCCC)CCCC