CAS 39122-38-8
:N-(pyridin-2-yl)pyridine-2-carbothioamide
Description:
N-(pyridin-2-yl)pyridine-2-carbothioamide, with the CAS number 39122-38-8, is a chemical compound characterized by its unique structure that includes two pyridine rings and a carbothioamide functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amide group. The presence of the pyridine rings contributes to its aromatic character, which can influence its reactivity and stability. Additionally, compounds like this one may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The thioamide functional group can also impart distinct chemical reactivity, such as the ability to participate in nucleophilic reactions. Overall, N-(pyridin-2-yl)pyridine-2-carbothioamide is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H9N3S
InChI:InChI=1/C11H9N3S/c15-11(9-5-1-3-7-12-9)14-10-6-2-4-8-13-10/h1-8H,(H,13,14,15)
SMILES:c1ccnc(c1)C(=Nc1ccccn1)S
Synonyms:- 2-pyridinecarbothioamide, N-2-pyridinyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-(Pyridin-2-yl)pyridine-2-carbothioamide
CAS:Formula:C11H9N3SPurity:98%Color and Shape:SolidMolecular weight:215.2743NSC 185058
CAS:NSC 185058 is an inhibitor of ATG4B, a major cysteine protease. It also can attenuate the autophagic activity.Formula:C11H9N3SPurity:99.27%Color and Shape:SolidMolecular weight:215.27NSC 185058
CAS:NSC 185058 is a potential cancer therapy that inhibits protein synthesis in the cell. It prevents cells from growing and dividing by inhibiting their ability to synthesize proteins. NSC 185058 also induces apoptotic cell death, which is programmed cell death that occurs as a result of genetic or environmental stress. When cells undergo apoptosis, they are able to destroy themselves without releasing harmful substances into the surrounding area. NSC 185058 has been shown to induce autophagy and autophagy-related proteins in animal models. Autophagy is a process by which cells break down dysfunctional components to recycle nutrients and energy for future use. NSC 185058 has also been shown to inhibit tumor growth in mice with malignant brain tumors when used in combination with other therapies such as radiation and chemotherapy.Formula:C11H9N3SPurity:Min. 95%Molecular weight:215.27 g/mol




