CAS 3914-42-9

2-(chloromethyl)-5-methyl-1,3,4-oxadiazole

Description:

2-(Chloromethyl)-5-methyl-1,3,4-oxadiazole is a heterocyclic organic compound characterized by its oxadiazole ring, which contains both nitrogen and oxygen atoms. This compound features a chloromethyl group (-CH2Cl) at the 2-position and a methyl group (-CH3) at the 5-position of the oxadiazole ring. The presence of the chloromethyl group makes it a reactive intermediate, often utilized in organic synthesis and medicinal chemistry for further functionalization. The oxadiazole ring contributes to the compound's stability and potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its reactivity and structural features make it of interest in various applications, including agrochemicals and pharmaceuticals. Safety precautions should be taken when handling this compound due to the presence of chlorine, which can pose health risks.

Formula: C₄H₅ClN₂O

InChI: InChI=1/C4H5ClN2O/c1-3-6-7-4(2-5)8-3/h2H2,1H3

SMILES: Cc1nnc(CCl)o1

Synonyms:

• 1,3,4-Oxadiazole, 2-(Chloromethyl)-5-Methyl-

2-(Chloromethyl)-5-methyl-1,3,4-oxadiazole

CAS: 3914-42-9

Formula: C₄H₅ClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 132.5483

Ref: IN-DA0032VA

2-(Chloromethyl)-5-methyl-1,3,4-oxadiazole

CAS: 3914-42-9

2-(Chloromethyl)-5-methyl-1,3,4-oxadiazole

Purity: 95%

Molecular weight: 132.55g/mol

Ref: 54-OR300709

2-(Chloromethyl)-5-methyl-1,3,4-oxadiazole

CAS: 3914-42-9

Formula: C₄H₅ClN₂O

Purity: 95%

Color and Shape: Powder

Molecular weight: 132.55

Ref: 10-F233368

Sitagliptin Impurity 56

CAS: 3914-42-9

Formula: C₄H₅ClN₂O

Molecular weight: 132.5

Ref: ST-EA-CP-S3099