CAS 39142-40-0

phenyl 1,3-thiazol-2-ylcarbamate

Description:

Phenyl 1,3-thiazol-2-ylcarbamate, with the CAS number 39142-40-0, is a chemical compound that belongs to the class of carbamates, which are esters or salts of carbamic acid. This substance features a phenyl group attached to a thiazole ring, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. The presence of the thiazole moiety contributes to its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Phenyl 1,3-thiazol-2-ylcarbamate is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which can influence its application in formulations. Its chemical structure allows for potential interactions with biological targets, and it may exhibit properties such as antimicrobial or herbicidal activity. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as well as environmental impact considerations.

Formula: C₁₀H₈N₂O₂S

InChI: InChI=1/C10H8N2O2S/c13-10(12-9-11-6-7-15-9)14-8-4-2-1-3-5-8/h1-7H,(H,11,12,13)

SMILES: c1ccc(cc1)OC(=Nc1nccs1)O

Synonyms:

• carbamic acid, N-2-thiazolyl-, phenyl ester
• Phenyl 1,3-thiazol-2-ylcarbamate

Phenyl N-(1,3-thiazol-2-yl)carbamate

CAS: 39142-40-0

Phenyl N-(1,3-thiazol-2-yl)carbamate is a crystal structure stabilizer. It is an oriented, two-dimensional molecule that contains two phenyl rings (-C6H5) connected to each other by a single bond and one thiazole ring (-N=C=S). The orientation of the molecule in space is stabilized by a dihedral angle of 60° between the two phenyl rings. This orientation causes the phenyl rings to point in opposite directions and prevents them from rotating around their axis.

Formula: C₁₀H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 220.25 g/mol

Ref: 3D-PBA14240