CAS 39149-13-8

[4-(acetylamino)phenoxy]acetic acid

Description:

[4-(Acetylamino)phenoxy]acetic acid, with the CAS number 39149-13-8, is a chemical compound characterized by its structure, which includes an acetylamino group and a phenoxy group attached to an acetic acid moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of both hydrophilic and hydrophobic functional groups. It exhibits properties that may include moderate acidity due to the carboxylic acid group, which can participate in hydrogen bonding and influence its reactivity. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its synthesis often involves the reaction of phenolic compounds with acetic anhydride or acetyl chloride, followed by subsequent reactions to introduce the acetic acid functionality. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₀H₁₁NO₄

InChI: InChI=1/C10H11NO4/c1-7(12)11-8-2-4-9(5-3-8)15-6-10(13)14/h2-5H,6H2,1H3,(H,11,12)(H,13,14)

SMILES: CC(=Nc1ccc(cc1)OCC(=O)O)O

Synonyms:

• (4-Acetamidophenoxy)acetic acid
• Acetic Acid, 2-[4-(Acetylamino)Phenoxy]-

(4-Acetamidophenoxy)acetic acid

CAS: 39149-13-8

Formula: C₁₀H₁₁NO₄

Purity: %

Color and Shape: Solid

Molecular weight: 209.1986

Ref: IN-DA00C8X1

2-(4-Acetamidophenoxy)acetic acid

CAS: 39149-13-8

2-(4-Acetamidophenoxy)acetic acid

Purity: 97%

Molecular weight: 209.20g/mol

Ref: 54-OR95925

2-(4-Acetamidophenoxy)acetic acid

CAS: 39149-13-8

Purity: 97%

Molecular weight: 209.201004

Ref: 10-F692736