CAS 39156-80-4
:Thulium acetate
Description:
Thulium acetate is a chemical compound composed of thulium, a rare earth element, and acetate ions. It typically appears as a crystalline solid and is known for its distinctive pale yellow color. Thulium acetate is soluble in water and polar organic solvents, which facilitates its use in various chemical applications. The compound is often utilized in research and industrial processes, particularly in the fields of materials science and catalysis. Thulium, being part of the lanthanide series, exhibits unique electronic and magnetic properties, making thulium acetate of interest in the development of advanced materials and technologies. Additionally, thulium compounds are studied for their potential applications in medical imaging and laser technologies due to their ability to emit specific wavelengths of light. Safety precautions should be observed when handling thulium acetate, as with all chemical substances, to prevent exposure and ensure proper laboratory practices.
Formula:C2H4O2Tm
InChI:InChI=1S/C2H4O2.Tm/c1-2(3)4;/h1H3,(H,3,4);
InChI key:InChIKey=CQUVSDBLYBZXRN-UHFFFAOYSA-N
SMILES:C(C)(O)=O.[Tm]
Synonyms:- Acetic acid, thulium(3+) salt
- Acetic acid, thulium(3+) salt (3:1)
- Thulium acetate
- Thulium triacetate
- Thulium(3+) acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
