CAS 3916-39-0

Z-Gly-Glu-OH

Description:

Z-Gly-Glu-OH, also known as Z-Glycine-L-Glutamic acid, is a dipeptide that consists of the amino acids glycine and glutamic acid, with a protective Z (benzyloxycarbonyl) group on the glycine residue. This compound is typically used in peptide synthesis and research due to its role in studying protein structure and function. The Z group serves to protect the amino group of glycine during chemical reactions, allowing for selective modifications. Z-Gly-Glu-OH is characterized by its ability to form hydrogen bonds, contributing to its solubility in polar solvents, and it exhibits properties typical of peptides, such as the potential to participate in various biochemical interactions. Its CAS number, 3916-39-0, is a unique identifier that facilitates the search for information regarding its properties, synthesis, and applications in scientific literature. Overall, Z-Gly-Glu-OH is a valuable compound in the field of biochemistry and peptide research.

Formula: C₁₅H₁₈N₂O₇

InChI: InChI=1/C15H18N2O7/c18-12(17-11(14(21)22)6-7-13(19)20)8-16-15(23)24-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,16,23)(H,17,18)(H,19,20)(H,21,22)

SMILES: c1ccc(cc1)COC(=NCC(=NC(CCC(=O)O)C(=O)O)O)O

Synonyms:

• N-[(benzyloxy)carbonyl]glycylglutamic acid

Z-Gly-Glu-OH

CAS: 3916-39-0

Please enquire for more information about Z-Gly-Glu-OH including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₅H₁₈N₂O₇

Purity: Min. 95%

Molecular weight: 338.31 g/mol

Ref: 3D-FG111464