CAS 391604-55-0
:2-(2,4-difluorophenyl)pyridine
Description:
2-(2,4-Difluorophenyl)pyridine is an organic compound characterized by its pyridine ring substituted with a 2,4-difluorophenyl group. This compound features a pyridine moiety, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for coordination with metal ions. The presence of the difluorophenyl group introduces significant electronic effects due to the electronegative fluorine atoms, which can influence the compound's reactivity and stability. Typically, such compounds exhibit moderate to high lipophilicity, making them relevant in medicinal chemistry and material science. The molecular structure allows for potential interactions in biological systems, which may lead to applications in pharmaceuticals or agrochemicals. Additionally, the compound's unique substitution pattern can affect its physical properties, such as melting point, boiling point, and solubility in various solvents. Overall, 2-(2,4-difluorophenyl)pyridine is of interest for its chemical properties and potential applications in various fields of research.
Formula:C11H7F2N
InChI:InChI=1/C11H7F2N/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11/h1-7H
SMILES:c1ccnc(c1)c1ccc(cc1F)F
Synonyms:- 2-(2,4-Diflurophenyl)Pyridine
- Pyridine, 2-(2,4-Difluorophenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(2,4-Difluorophenyl)pyridine
CAS:Formula:C11H7F2NPurity:>98.0%(GC)(T)Color and Shape:White or Colorless to Light yellow to Light orange powder to lump to clear liquidMolecular weight:191.182-(2,4-Difluorophenyl)pyridine
CAS:Formula:C11H7F2NPurity:97%Color and Shape:LiquidMolecular weight:191.17682-(2,4-Difluorophenyl)pyridine
CAS:2-(2,4-Difluorophenyl)pyridineFormula:C11H7F2NPurity:98%Color and Shape: clear. light yellow liquidMolecular weight:191.18g/mol2-(2,4-Difluorophenyl)pyridine
CAS:Formula:C11H7F2NPurity:97%Color and Shape:LiquidMolecular weight:191.1812-(2,4-Difluorophenyl)pyridine
CAS:2-(2,4-Difluorophenyl)pyridine (2DPP) is a x-ray crystal structure that has been shown to be ancillary and have anticancer activity. 2DPP has a redox potential of -0.52 V, which is high resistance against reduction. It is also an aldehyde group with two nitrogen atoms and two hydrochloric acid groups. 2DPP can produce light emission in the presence of chloride and picolinic acid and has been shown to be photophysics. The structural analysis of 2DPP reveals that it has a molecular weight of 184.07 g/mol and a melting point of 272 degrees Celsius. This compound also binds to mitochondrial membranes in the presence of light, which is responsible for its optical properties.Formula:C11H7F2NPurity:Min. 95%Color and Shape:Colourless To Light (Or Pale) Yellow To Tan LiquidMolecular weight:191.18 g/mol




