CAS 39161-84-7
:4-Mercaptophenylacetic acid
Description:
4-Mercaptophenylacetic acid is an organic compound characterized by the presence of both a thiol (-SH) group and a carboxylic acid (-COOH) group attached to a phenyl ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to its functional groups. The thiol group imparts unique reactivity, allowing for the formation of disulfide bonds and participation in various chemical reactions, including nucleophilic substitutions and redox reactions. The carboxylic acid group contributes to its acidity and can engage in hydrogen bonding, enhancing its solubility in water. 4-Mercaptophenylacetic acid is often utilized in organic synthesis, particularly in the development of pharmaceuticals and as a building block in the preparation of more complex molecules. Additionally, its thiol functionality makes it valuable in bioconjugation and materials science applications, such as the modification of surfaces and the creation of thiol-ene polymers. Overall, this compound is notable for its dual functional properties, making it versatile in various chemical contexts.
Formula:C8H8O2S
InChI:InChI=1S/C8H8O2S/c9-8(10)5-6-1-3-7(11)4-2-6/h1-4,11H,5H2,(H,9,10)
InChI key:InChIKey=ORXSLDYRYTVAPC-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC=C(S)C=C1
Synonyms:- (4-Carboxymethyl)thiophenol
- (4-Sulfanylphenyl)acetic acid
- 2-(4-Mercaptophenyl)acetic acid
- 2-(4-Sulfanylphenyl)acetic acid
- 4-Mercaptobenzeneacetic Acid
- Benzeneacetic Acid, 4-Mercapto-
- p-Mercaptophenylacetic acid
- 4-Mercaptophenylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Mercaptophenylacetic acid, 97%
CAS:An useful synthetic intermediate for the preparation of novel anti inflammatory agents. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / itFormula:C8H8O2SPurity:97%Color and Shape:Powder, White to pale creamMolecular weight:168.212-(4-Mercaptophenyl)acetic acid
CAS:Formula:C8H8O2SPurity:95%Color and Shape:SolidMolecular weight:168.2129Ref: IN-DA003LLY
1g68.00€5g121.00€25g539.00€100gTo inquire250gTo inquire500gTo inquire100mg26.00€250mg31.00€2-(4-Mercaptophenyl)acetic Acid
CAS:Formula:C8H8O2SPurity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:168.214-Mercaptophenylacetic acid
CAS:4-Mercaptophenylacetic acid is a palladium complex that inhibits the synthesis of proteins by binding to the ribosome and blocking peptide bond formation. The molecule has a polymeric matrix with a high degree of crystallinity and an isolated yield of greater than 95%. 4-Mercaptophenylacetic acid is immobilized on a carboxylate surface and has been shown to have pharmacokinetic properties. It can be used in the treatment of cancer cells and inhibits protein synthesis, leading to cell death. 4-Mercaptophenylacetic acid also has anti-inflammatory activities due to its inhibition of prostaglandin synthesis.Formula:C8H8O2SPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:168.21 g/mol4-Mercaptophenylacetic acid
CAS:Formula:C8H8O2SPurity:95%Color and Shape:CrystallineMolecular weight:168.214-Mercaptophenylacetic Acid
CAS:Controlled ProductApplications A redox buffer that increases the folding rate of disulfide-containing proteins realative to traditional buffers such as glutathione and glutathione-disulfide. A useful synthetic intermediate for the preparation of novel antiinflammatory agents.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Gough, J.D., et al.: JACS, 124 (15), 3885 (2002)Formula:C8H8O2SColor and Shape:NeatMolecular weight:168.21






