CAS 39165-03-2
:2-ethynyl-1-benzofuran
Description:
2-Ethynyl-1-benzofuran is an organic compound characterized by its unique structure, which combines a benzofuran moiety with an ethynyl group. This compound features a fused benzene and furan ring, contributing to its aromatic properties and potential reactivity. The ethynyl group, a terminal alkyne, introduces a triple bond that can participate in various chemical reactions, such as nucleophilic additions or cycloadditions. 2-Ethynyl-1-benzofuran is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, making it useful in organic synthesis and materials science. The compound may exhibit interesting photophysical properties, which can be exploited in applications such as fluorescent probes or in the development of organic light-emitting diodes (OLEDs). Additionally, due to its structural features, it may possess biological activity, warranting further investigation in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H6O
InChI:InChI=1/C10H6O/c1-2-9-7-8-5-3-4-6-10(8)11-9/h1,3-7H
SMILES:C#Cc1cc2ccccc2o1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Ethynyl-1-benzofuran
CAS:<p>2-Ethynyl-1-benzofuran is a ligand in organic chemistry that can react with an oxidant to form terminal alkynes. It has been shown to undergo hydrofunctionalization and stereocontrol, which are two of the most commonly studied reactions in organic chemistry. This compound is also used as a precursor for benzofurans, which are important organic compounds that have been studied extensively due to their structural diversity. 2-Ethynyl-1-benzofuran is synthesized from azides and aldehydes or triazoles, which can be obtained through advances in organic chemistry.</p>Formula:C10H6OPurity:Min. 95%Molecular weight:142.15 g/mol
