CAS 39170-18-8
:5-Phenyl-2-furanmethanamine
Description:
5-Phenyl-2-furanmethanamine, with the CAS number 39170-18-8, is an organic compound characterized by its furan and phenyl functional groups. This compound features a furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom, and an amine group (-NH2) attached to a methylene bridge (-CH2-) that connects to a phenyl group. The presence of the phenyl group contributes to its aromatic properties, while the furan ring imparts unique reactivity and potential biological activity. This compound may exhibit various physical properties such as solubility in organic solvents and moderate stability under standard conditions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological significance of both furan and phenyl moieties. Additionally, the amine functionality may allow for further derivatization, enhancing its utility in synthetic chemistry. However, specific data regarding its toxicity, environmental impact, and detailed reactivity would require further investigation and analysis.
Formula:C11H11NO
InChI:InChI=1S/C11H11NO/c12-8-10-6-7-11(13-10)9-4-2-1-3-5-9/h1-7H,8,12H2
InChI key:InChIKey=HQHHWOJYOUTZHZ-UHFFFAOYSA-N
SMILES:C(N)C=1OC(=CC1)C2=CC=CC=C2
Synonyms:- 2-Furanmethanamine, 5-phenyl-
- (5-Phenylfuran-2-yl)methanamine
- 5-Phenyl-2-furanmethanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(5-Phenylfuran-2-yl)methanamine
CAS:(5-Phenylfuran-2-yl)methanaminePurity:95%Molecular weight:173.21g/mol(5-Phenylfuran-2-yl)methanamine
CAS:(5-Phenylfuran-2-yl)methanamine is a drug that has been shown to be effective in treating neurodegenerative diseases and cancer. It is a member of the sirtuin family, which are enzymes that regulate gene expression. The drug inhibits SIRT2 and other deacetylases, which may lead to the development of new treatment strategies for neurodegenerative diseases and cancer. (5-Phenylfuran-2-yl)methanamine has high water solubility, which allows it to penetrate through the blood brain barrier more effectively than hydrophobic drugs. This property also makes it possible to administer lower doses of the drug, thereby reducing side effects on healthy cells.
Formula:C11H11NOPurity:Min. 95%Molecular weight:173.21 g/mol

