CymitQuimica logo

CAS 39172-32-2

:

2-(3-bromophenyl)-2-methyl-1,3-dioxolane

Description:
2-(3-Bromophenyl)-2-methyl-1,3-dioxolane is an organic compound characterized by its unique structure, which includes a dioxolane ring and a bromophenyl substituent. The presence of the dioxolane ring, a five-membered cyclic ether, contributes to its stability and reactivity, particularly in nucleophilic substitution reactions. The bromine atom on the phenyl ring enhances the compound's electrophilic character, making it a potential candidate for various chemical transformations. This compound is typically colorless to pale yellow in appearance and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis due to the functional groups present. Additionally, the bromine substituent can influence the compound's physical properties, such as boiling point and melting point, as well as its reactivity in chemical reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-(3-bromophenyl)-2-methyl-1,3-dioxolane is a versatile compound with interesting chemical properties.
Formula:C10H11BrO2
InChI:InChI=1/C10H11BrO2/c1-10(12-5-6-13-10)8-3-2-4-9(11)7-8/h2-4,7H,5-6H2,1H3
InChI key:BMECYBCLXRLALS-UHFFFAOYSA-N
SMILES:CC1(c2cccc(c2)Br)OCCO1
Synonyms:
  • 1,3-Dioxolane, 2-(3-bromophenyl)-2-methyl-
Found 3 products.