CAS 3918-90-9
:phe-val
Description:
The chemical substance known as "phe-val," with the CAS number 3918-90-9, is a dipeptide composed of phenylalanine and valine. It is characterized by its structure, which consists of the amino acids phenylalanine (an aromatic amino acid) and valine (a branched-chain amino acid) linked by a peptide bond. This dipeptide exhibits properties typical of peptides, such as solubility in water and the ability to participate in various biochemical reactions. Phe-val may play a role in protein synthesis and can be involved in various metabolic processes. Its specific characteristics, such as stability, reactivity, and biological activity, can vary depending on the conditions under which it is studied, including pH, temperature, and the presence of other substances. Additionally, like many peptides, it may have implications in nutrition and health, particularly in relation to protein intake and amino acid balance in the body. Further research may provide insights into its potential applications in pharmaceuticals or nutrition.
Formula:C14H20N2O3
InChI:InChI=1/C14H20N2O3/c1-9(2)12(14(18)19)16-13(17)11(15)8-10-6-4-3-5-7-10/h3-7,9,11-12H,8,15H2,1-2H3,(H,16,17)(H,18,19)/t11-,12-/m0/s1
SMILES:CC(C)[C@@H](C(=O)O)N=C([C@H](Cc1ccccc1)N)O
Synonyms:- H-Phe-Val-OH
- L-Phenylalanyl-L-valine
- (2S)-2-{[(2S)-2-ammonio-3-phenylpropanoyl]amino}-3-methylbutanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-Phe-Val-OH
CAS:Bachem ID: 4001025.
Formula:C14H20N2O3Purity:> 99%Color and Shape:White PowderMolecular weight:264.32(S)-2-((S)-2-Amino-3-phenylpropanamido)-3-methylbutanoic acid
CAS:Formula:C14H20N2O3Purity:97%Color and Shape:SolidMolecular weight:264.3202H-Phe-Val-OH
CAS:H-Phe-Val-OH, also known as humanized Val-Phe-His-Leu (VHL), is a monoclonal antibody that binds to the antigen epidermal growth factor (EGF). It has been shown to have diagnostic and therapeutic properties in vitro. This antibody is used in the diagnosis of cancer tissues and is able to identify carcinoma cell lines. Furthermore, it can be used to diagnose hepatitis C virus infection. H-Phe-Val-OH blocks the binding of EGF with its receptor on the surface of cells and prevents the proliferation of cancerous cells. It also inhibits cancer growth by reducing the synthesis of proteins such as epidermal growth factor and transforming growth factor alpha.Formula:C14H20N2O3Purity:Min. 98%Color and Shape:PowderMolecular weight:264.32 g/mol


