CAS 39181-45-8

5-(4-methylbenzyl)-1,3,4-thiadiazol-2-amine

Description:

5-(4-Methylbenzyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its thiadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and one sulfur atom. This compound features a 4-methylbenzyl group, which contributes to its hydrophobic characteristics and potential biological activity. The presence of an amine functional group enhances its reactivity and solubility in polar solvents. Thiadiazoles are known for their diverse biological activities, including antimicrobial and antifungal properties, making this compound of interest in pharmaceutical research. Its molecular structure allows for various interactions with biological targets, potentially leading to therapeutic applications. The compound's CAS number, 39181-45-8, provides a unique identifier for regulatory and safety information. Overall, 5-(4-methylbenzyl)-1,3,4-thiadiazol-2-amine exemplifies the complexity and utility of heterocyclic compounds in medicinal chemistry.

Formula: C₁₀H₁₁N₃S

InChI: InChI=1/C10H11N3S/c1-7-2-4-8(5-3-7)6-9-12-13-10(11)14-9/h2-5H,6H2,1H3,(H2,11,13)

SMILES: Cc1ccc(cc1)Cc1n[nH]c(=N)s1

5-(4-Methylbenzyl)-1,3,4-thiadiazol-2-amine

CAS: 39181-45-8

Formula: C₁₀H₁₁N₃S

Color and Shape: Solid

Molecular weight: 205.2794

Ref: IN-DA00BZ6U

5-(4-methylbenzyl)-1,3,4-thiadiazol-2-amine

CAS: 39181-45-8

Formula: C₁₀H₁₁N₃S

Purity: 95.0%

Molecular weight: 205.28

Ref: 10-F316003