CAS 391864-00-9: 2-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide

Description: 2-Chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide is a chemical compound characterized by its unique structure, which includes a chloro group and a thiadiazole moiety. The presence of the chloro substituent typically imparts reactivity, making it useful in various synthetic applications. The thiadiazole ring contributes to the compound's biological activity, often enhancing its potential as a pharmaceutical agent or agrochemical. This compound is likely to exhibit moderate to high solubility in polar solvents due to the presence of the amide functional group, which can engage in hydrogen bonding. Additionally, the ethyl group attached to the thiadiazole ring may influence its lipophilicity and overall stability. The compound's molecular interactions and reactivity can be further explored through various analytical techniques, including NMR and mass spectrometry. Overall, 2-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide represents a class of compounds with potential applications in medicinal chemistry and material science.

Formula: C₇H₁₀ClN₃OS

InChI: InChI=1/C7H10ClN3OS/c1-3-5-10-11-7(13-5)9-6(12)4(2)8/h4H,3H2,1-2H3,(H,9,11,12)

Synonyms:

• propanamide, 2-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-

2-CHLORO-N-(5-ETHYL-1,3,4-THIADIAZOL-2-YL)PROPANAMIDE

CAS: 391864-00-9

• Formula: C₇H₁₀ClN₃OS
• Molecular weight: 219.6918

2-chloro-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide

CAS: 391864-00-9

• Purity: 95.0%
• Molecular weight: 219.69000244140625