CAS 39190-77-7
:N-ethylpentan-3-amine
Description:
N-ethylpentan-3-amine, with the CAS number 39190-77-7, is an organic compound classified as an amine. It features a pentane backbone with an ethyl group attached to the nitrogen atom, specifically at the third carbon position. This structure gives it unique properties, including being a colorless to pale yellow liquid at room temperature. N-ethylpentan-3-amine is characterized by its amine functional group, which imparts basicity and the ability to form hydrogen bonds, influencing its solubility in polar solvents like water. The compound may exhibit moderate volatility and has a distinct amine odor. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, although specific applications may vary. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Overall, N-ethylpentan-3-amine is a versatile compound with notable chemical characteristics stemming from its amine structure.
Formula:C7H17N
InChI:InChI=1/C7H17N/c1-4-7(5-2)8-6-3/h7-8H,4-6H2,1-3H3
SMILES:CCC(CC)NCC
Synonyms:- 3-pentanamine, N-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.