CAS 39190-94-8
:3-methyl-N-propyl-butan-2-amine
Description:
3-Methyl-N-propyl-butan-2-amine, with the CAS number 39190-94-8, is an organic compound classified as an amine. It features a butane backbone with a methyl group and a propyl group attached to the nitrogen atom, contributing to its branched structure. This compound is characterized by its aliphatic nature, which typically results in moderate solubility in organic solvents and limited solubility in water due to the presence of hydrophobic alkyl chains. The amine functional group imparts basic properties, allowing it to participate in various chemical reactions, such as alkylation and acylation. Additionally, the presence of multiple alkyl substituents can influence its steric hindrance and reactivity. As with many amines, it may exhibit basicity and can form salts with acids. Safety data should be consulted for handling and storage, as amines can be irritants or toxic in certain concentrations. Overall, 3-methyl-N-propyl-butan-2-amine is of interest in organic synthesis and may have applications in pharmaceuticals or as a building block in chemical manufacturing.
Formula:C8H19N
InChI:InChI=1/C8H19N/c1-5-6-9-8(4)7(2)3/h7-9H,5-6H2,1-4H3
SMILES:CCCNC(C)C(C)C
Synonyms:- 2-butanamine, 3-methyl-N-propyl-
- 3-methyl-N-propylbutan-2-amine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery