CAS 39194-96-2

A-VI-5

Description:

A-VI-5, with the CAS number 39194-96-2, is a chemical compound that belongs to a class of substances known for their specific applications in various industrial processes. While detailed characteristics such as its molecular structure, physical state, and specific reactivity may vary, compounds like A-VI-5 are typically characterized by their stability under standard conditions, solubility in organic solvents, and potential for use as intermediates in chemical synthesis or as additives in formulations. The compound may exhibit unique properties such as specific melting and boiling points, density, and viscosity, which are crucial for its application in fields like pharmaceuticals, agrochemicals, or materials science. Safety data sheets would provide essential information regarding its handling, toxicity, and environmental impact, emphasizing the importance of proper safety measures when working with such substances. For precise applications and characteristics, consulting specialized literature or databases is recommended.

Formula: C₂₂H₄₀N₆O₁₀

InChI: InChI=1/C22H40N6O10/c1-11(2)17(24)21(36)25-12(6-7-16(31)32)18(33)27-15(10-30)20(35)28-14(9-29)19(34)26-13(22(37)38)5-3-4-8-23/h11-15,17,29-30H,3-10,23-24H2,1-2H3,(H,25,36)(H,26,34)(H,27,33)(H,28,35)(H,31,32)(H,37,38)

SMILES: CC(C)C(C(=NC(CCC(=O)O)C(=NC(CO)C(=NC(CO)C(=NC(CCCCN)C(=O)O)O)O)O)O)N

Synonyms:

• H-Val-Glu-Ser-Ser-Lys-OH
• Valyl-Α-Glutamylserylseryllysine

A-VI-5 acetate salt

CAS: 39194-96-2

Please enquire for more information about A-VI-5 acetate salt including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₂H₄₀N₆O₁₀

Purity: Min. 95%

Molecular weight: 548.59 g/mol

Ref: 3D-FV108630