CAS 39198-79-3
:4-Cycloheptylmorpholine
Description:
4-Cycloheptylmorpholine is a chemical compound characterized by its morpholine structure, which is a six-membered ring containing both nitrogen and oxygen atoms. The presence of a cycloheptyl group at the 4-position of the morpholine ring contributes to its unique properties, including its potential as a building block in organic synthesis and medicinal chemistry. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits moderate solubility in polar solvents, which can influence its reactivity and interactions with biological systems. The nitrogen atom in the morpholine ring can participate in hydrogen bonding, making it a versatile compound in various chemical reactions. Additionally, 4-Cycloheptylmorpholine may exhibit biological activity, which could be of interest in pharmaceutical research. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 4-Cycloheptylmorpholine represents a valuable compound in the field of organic chemistry and drug development.
Formula:C11H21NO
InChI:InChI=1S/C11H21NO/c1-2-4-6-11(5-3-1)12-7-9-13-10-8-12/h11H,1-10H2
InChI key:InChIKey=OANBWYYAUQHQFP-UHFFFAOYSA-N
SMILES:N1(CCOCC1)C2CCCCCC2
Synonyms:- Morpholine, 4-Cycloheptyl-
- N-Cycloheptylmorpholine
- 4-Cycloheptylmorpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.