CAS 392-63-2
:N,N-diethyl-2,3,3,3-tetrafluoropropionamide
Description:
N,N-Diethyl-2,3,3,3-tetrafluoropropionamide is an organic compound characterized by its unique fluorinated structure, which contributes to its chemical properties and potential applications. It features a propionamide backbone with two ethyl groups attached to the nitrogen atom and four fluorine atoms substituted on the carbon chain. This fluorination enhances its lipophilicity and stability, making it useful in various chemical processes. The compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its low volatility and relatively high boiling point, which can be advantageous in certain applications. Additionally, N,N-diethyl-2,3,3,3-tetrafluoropropionamide may exhibit unique reactivity due to the presence of the electronegative fluorine atoms, influencing its interactions with other chemical species. Safety data indicates that, like many fluorinated compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Its specific applications can vary, but it is often explored in fields such as pharmaceuticals and agrochemicals.
Formula:C7H11F4NO
InChI:InChI=1/C7H11F4NO/c1-3-12(4-2)6(13)5(8)7(9,10)11/h5H,3-4H2,1-2H3
SMILES:CCN(CC)C(=O)C(C(F)(F)F)F
Synonyms:- N,N-diethyl-2,2,3,3-tetrafluoropropanamide
- N,N-diethyl-2,3,3,3-tetrafluoropropanamide
- N,N-Diethyl-2,3,3,3-tetrafluoropropionamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N,N-Diethyl-2,3,3,3-tetrafluoropropionamide, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7F4H11NOPurity:95%Color and Shape:Clear colorless to pale yellow or pale orange or pale pink, LiquidMolecular weight:201.16N,N-Diethyl-2,3,3,3-tetrafluoropropanamide
CAS:Formula:C7H11F4NOPurity:95%Color and Shape:LiquidMolecular weight:201.1620N,N-Diethyl-2,3,3,3-tetrafluoropropanamide
CAS:N,N-Diethyl-2,3,3,3-tetrafluoropropanamideFormula:C7H11F4NOPurity:98%Color and Shape: clear. faint orange liquidMolecular weight:201.16g/mol



