CAS 39201-33-7
:4-cyanobutanoic acid
Description:
4-Cyanobutanoic acid, with the CAS number 39201-33-7, is an organic compound characterized by a four-carbon chain with a carboxylic acid group (-COOH) and a cyano group (-CN) attached to the fourth carbon. This compound is a colorless to pale yellow solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid functional group. It exhibits acidic properties, allowing it to donate protons in solution. The cyano group contributes to its reactivity, making it useful in various chemical syntheses, including the production of pharmaceuticals and agrochemicals. Additionally, 4-cyanobutanoic acid can participate in nucleophilic addition reactions and can serve as a building block for more complex molecules. Its structural features also suggest potential applications in materials science, particularly in the development of polymers and other functional materials. Safety data indicates that, like many cyanide-containing compounds, it should be handled with care due to potential toxicity.
Formula:C5H7NO2
InChI:InChI=1/C5H7NO2/c6-4-2-1-3-5(7)8/h1-3H2,(H,7,8)
SMILES:C(CC#N)CC(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Cyanobutanoic acid
CAS:<p>4-Cyanobutanoic acid is a colorless organic solvent that is not soluble in water or polar organic solvents. It can be used for the immobilization of proteins, as well as for the desymmetrization and chlorination of aromatic compounds. One of its most common uses is in biocatalysis, where it acts as a substrate binding agent to help catalyze reactions. 4-Cyanobutanoic acid has also been shown to inhibit the growth of bacteria by acting as an electron acceptor during metabolism. This compound can be degraded through hydrolysis with hydrochloric acid or biodegradation.</p>Formula:C5H7NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:113.11 g/mol
