CAS 39202-36-3
:1,17-Diamino-9-azaheptadecane
Description:
1,17-Diamino-9-azaheptadecane, with the CAS number 39202-36-3, is a polyamine compound characterized by the presence of two amino groups (-NH2) and a nitrogen atom integrated into a 17-carbon chain. This structure contributes to its unique properties, including its potential for forming hydrogen bonds and participating in various chemical reactions. The presence of multiple amine groups enhances its solubility in polar solvents and may facilitate interactions with biological molecules, making it of interest in biochemical applications. The compound's long carbon chain can influence its hydrophobic characteristics, while the nitrogen atoms can impart basicity and reactivity. Additionally, 1,17-Diamino-9-azaheptadecane may exhibit potential as a ligand in coordination chemistry or as a building block in the synthesis of more complex organic molecules. Its specific applications and behavior in various environments would depend on factors such as pH, temperature, and the presence of other chemical species. Overall, this compound represents a versatile structure with potential utility in both industrial and research settings.
Formula:C16H37N3
InChI:InChI=1S/C16H37N3/c17-13-9-5-1-3-7-11-15-19-16-12-8-4-2-6-10-14-18/h19H,1-18H2
InChI key:InChIKey=ZWZITQBHEXYRNP-UHFFFAOYSA-N
SMILES:N(CCCCCCCCN)CCCCCCCCN
Synonyms:- 1,17-Diamino-9-azaheptadecane
- 1,8-Octanediamine, N-(8-aminooctyl)-
- 1,8-Octanediamine, N<sup>1</sup>-(8-aminooctyl)-
- 1,8-octanediamine, N~1~-(8-aminooctyl)-
- 9-Aza-1,17-diaminoheptadecane
- Bis(8-aminoctyl)amine
- Dioctamethylenetriamine
- N<sup>1</sup>-(8-Aminooctyl)-1,8-octanediamine
- 1,8-Octanediamine, N1-(8-aminooctyl)-
- N1-(8-Aminooctyl)-1,8-octanediamine
- N-(8-Aminooctyl)octane-1,8-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(8-Aminooctyl)-1,8-octanediamine
CAS:Controlled ProductFormula:C16H37N3Color and Shape:NeatMolecular weight:271.485
